![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2006 NAOMS - NYT Op-ed.pdf | 2009-11-17 13:29 | 76K | |
| 2006_nytimes_pilots_krosnick.pdf | 2010-12-17 16:28 | 76K | |
| 2006_nytimes_krosnick.pdf | 2010-12-17 16:28 | 109K | |
| 2006_jcomm_krosnick.pdf | 2011-01-24 10:46 | 123K | |
| 2006 exploring the latent structure of strength related attitude .pdf | 2010-08-20 10:34 | 288K | |
| 2006_mercnews_krosnick.pdf | 2010-12-17 16:28 | 310K | |
| 2006 Ballot Order Mercury News Scan.pdf | 2009-11-17 13:25 | 310K | |
| 2006 GW National Seriousness.pdf | 2010-08-20 10:34 | 347K | |
| 2006 Advances Chapter.pdf | 2011-10-03 11:23 | 448K | |
| 2006 Attitude Measurement Techniques for Measuring the Unobservab.pdf | 2010-08-20 10:34 | 1.0M | |
| 2006 optimizing brief assessments 2.pdf | 2010-08-20 10:35 | 1.4M | |
| 2006 Student Reactions to being Wrongly Information of Failing a High-Stakes Test.pdf | 2009-11-17 13:28 | 1.6M | |
| 2006_advespvol38_visser.pdf | 2010-12-17 16:27 | 46M | |